What is the name of C6H16N2?
What is the name of C6H16N2?
Hexanediamine
Hexanediamine | C6H16N2 – PubChem.
What is the name of C3H7COO?
Sodium butyrate is a compound with formula Na(C3H7COO). It is the sodium salt of butyric acid.
What is the name of C7H6?
Dehydrotoluene | C7H6 – PubChem.
What is the empirical formula for C6H16N2?
Identification of 1,6-Hexanediamine Chemical Compound
| Chemical Formula | C6H16N2 |
|---|---|
| IUPAC Name | hexane-1,6-diamine |
| SMILES String | NCCCCCCN |
| InChI | InChI=1S/C6H16N2/c7-5-3-1-2-4-6-8/h1-8H2 |
| InChIKey | NAQMVNRVTILPCV-UHFFFAOYSA-N |
How do you make hexamethylenediamine?
Hexamethylenediamine was first reported by Theodor Curtius. It is produced by the hydrogenation of adiponitrile: NC(CH2)4CN + 4 H2 → H2N(CH2)6NH. The hydrogenation is conducted on molten adiponitrile diluted with ammonia, typical catalysts being based on cobalt and iron.
What is the IUPAC name of acetamide?
| IUPAC Name | acetamide |
|---|---|
| Alternative Names | acetamide Ethanamide Acetic acid amide Methanecarboxamide Acetimidic acid |
| Molecular Formula | C2H5NO |
| Molar Mass | 59.068 g/mol |
| InChI | InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) |
What is the structural formula of Ethanamide?
C2H5NOAcetamide / Formula
Acetamide Formula and Structure The chemical formula of acetamide is C2H5NO or CH3CONH2. Moreover, its molar mass is 59.07 g/mol.
What is the name of the compound C7H16?
Heptane or n-heptane is the straight-chain alkane with the chemical formula H3C(CH2)5CH3 or C7H16, and is one of the main components of gasoline (petrol).
What is the molar mass of C7H16?
100.21 g/moln-Heptane / Molar mass
How is hexamethylenediamine formed?
What is acetamide chemical formula?
C2H5NOAcetamide / Formula
What is the functional group of acetamide?
carboxylic acid amide functional group
Acetamide Formula and Structure The acetamide has a methyl group (-CH3) bound to a carbonyl (CO) and Amine (NH2). Besides, the acetamide primarily comprises of carboxylic acid amide functional group that has a general structure RC (=O) NH2.